C16H18F3N5O2 — CID 124984378
(2S)-1-methyl-4-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]piperazine-2-carboxamide (PubChem CID 124984378) has the molecular formula C16H18F3N5O2 and a molecular weight of 369.35 g/mol. Its IUPAC name is (2S)-1-methyl-4-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]piperazine-2-carboxamide.
| Compound Name | (2S)-1-methyl-4-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124984378 |
| Molecular Formula | C16H18F3N5O2 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2S)-1-methyl-4-[2-[2-(trifluoromethyl)benzimidazol-1-yl]acetyl]piperazine-2-carboxamide |
| SMILES | CN1CCN(C(=O)Cn2c(C(F)(F)F)nc3ccccc32)C[C@H]1C(N)=O |
| InChI | InChI=1S/C16H18F3N5O2/c1-22-6-7-23(8-12(22)14(20)26)13(25)9-24-11-5-3-2-4-10(11)21-15(24)16(17,18)19/h2-5,12H,6-9H2,1H3,(H2,20,26)/t12-/m0/s1 |
| InChIKey | NKHMTHMJKMHIOW-LBPRGKRZSA-N |
| XLogP | 0.68 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |