C14H24ClN3O5S — CID 120984636
2-amino-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide;hydrochloride (PubChem CID 120984636) has the molecular formula C14H24ClN3O5S and a molecular weight of 381.88 g/mol. Its IUPAC name is 2-amino-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide;hydrochloride.
| Compound Name | 2-amino-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 120984636 |
| Molecular Formula | C14H24ClN3O5S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-amino-N-[3-(dimethylsulfamoyl)-4-ethoxyphenyl]-3-methoxypropanamide;hydrochloride |
| SMILES | CCOc1ccc(NC(=O)C(N)COC)cc1S(=O)(=O)N(C)C.Cl |
| InChI | InChI=1S/C14H23N3O5S.ClH/c1-5-22-12-7-6-10(16-14(18)11(15)9-21-4)8-13(12)23(19,20)17(2)3;/h6-8,11H,5,9,15H2,1-4H3,(H,16,18);1H |
| InChIKey | FIIXDCLZDKELOA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |