C28H30N2O6 — CID 46554620
N-[4-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2,5-diethoxyphenyl]benzamide (PubChem CID 46554620) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[4-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2,5-diethoxyphenyl]benzamide.
| Compound Name | N-[4-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2,5-diethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 46554620 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | N-[4-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2,5-diethoxyphenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)/C=C/c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C28H30N2O6/c1-5-35-25-18-24(30-28(32)20-10-8-7-9-11-20)26(36-6-2)17-23(25)29-27(31)13-12-19-14-21(33-3)16-22(15-19)34-4/h7-18H,5-6H2,1-4H3,(H,29,31)(H,30,32)/b13-12+ |
| InChIKey | CKHYXEBLQZHZNW-OUKQBFOZSA-N |
| XLogP | 5.41 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|