C33H32N2O7 — CID 4025593
N-(4-benzamido-2,5-diethoxyphenyl)-4-(2,5-dimethoxybenzoyl)benzamide (PubChem CID 4025593) has the molecular formula C33H32N2O7 and a molecular weight of 568.63 g/mol. Its IUPAC name is N-(4-benzamido-2,5-diethoxyphenyl)-4-(2,5-dimethoxybenzoyl)benzamide.
| Compound Name | N-(4-benzamido-2,5-diethoxyphenyl)-4-(2,5-dimethoxybenzoyl)benzamide |
|---|---|
| PubChem CID | 4025593 |
| Molecular Formula | C33H32N2O7 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | N-(4-benzamido-2,5-diethoxyphenyl)-4-(2,5-dimethoxybenzoyl)benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccc(C(=O)c3cc(OC)ccc3OC)cc2)c(OCC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H32N2O7/c1-5-41-29-20-27(30(42-6-2)19-26(29)34-32(37)22-10-8-7-9-11-22)35-33(38)23-14-12-21(13-15-23)31(36)25-18-24(39-3)16-17-28(25)40-4/h7-20H,5-6H2,1-4H3,(H,34,37)(H,35,38) |
| InChIKey | APHPVTUUXUSKPQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |