C30H34N2O6 — CID 19236857
N-[4-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-2,5-dimethoxyphenyl]benzamide (PubChem CID 19236857) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is N-[4-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-2,5-dimethoxyphenyl]benzamide.
| Compound Name | N-[4-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-2,5-dimethoxyphenyl]benzamide |
|---|---|
| PubChem CID | 19236857 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | N-[4-[[(E)-3-(4-butoxy-3-ethoxyphenyl)prop-2-enoyl]amino]-2,5-dimethoxyphenyl]benzamide |
| SMILES | CCCCOc1ccc(/C=C/C(=O)Nc2cc(OC)c(NC(=O)c3ccccc3)cc2OC)cc1OCC |
| InChI | InChI=1S/C30H34N2O6/c1-5-7-17-38-25-15-13-21(18-28(25)37-6-2)14-16-29(33)31-23-19-27(36-4)24(20-26(23)35-3)32-30(34)22-11-9-8-10-12-22/h8-16,18-20H,5-7,17H2,1-4H3,(H,31,33)(H,32,34)/b16-14+ |
| InChIKey | QWSKTPOPPCSHRV-JQIJEIRASA-N |
| XLogP | 6.19 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|