C19H19NO3 — CID 94763034
(E)-N-(5-formyl-2-propoxyphenyl)-3-phenylprop-2-enamide (PubChem CID 94763034) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (E)-N-(5-formyl-2-propoxyphenyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(5-formyl-2-propoxyphenyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 94763034 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (E)-N-(5-formyl-2-propoxyphenyl)-3-phenylprop-2-enamide |
| SMILES | CCCOc1ccc(C=O)cc1NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-2-12-23-18-10-8-16(14-21)13-17(18)20-19(22)11-9-15-6-4-3-5-7-15/h3-11,13-14H,2,12H2,1H3,(H,20,22)/b11-9+ |
| InChIKey | WZUUZFMMCASKLW-PKNBQFBNSA-N |
| XLogP | 3.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|