C20H21NO5 — CID 45383023
4-[[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-methylbenzoic acid (PubChem CID 45383023) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 4-[[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-methylbenzoic acid.
| Compound Name | 4-[[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 45383023 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 4-[[(E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoyl]amino]-3-methylbenzoic acid |
| SMILES | CCOc1cc(/C=C/C(=O)Nc2ccc(C(=O)O)cc2C)ccc1OC |
| InChI | InChI=1S/C20H21NO5/c1-4-26-18-12-14(5-9-17(18)25-3)6-10-19(22)21-16-8-7-15(20(23)24)11-13(16)2/h5-12H,4H2,1-3H3,(H,21,22)(H,23,24)/b10-6+ |
| InChIKey | QEZIILSGFWCGOF-UXBLZVDNSA-N |
| XLogP | 3.75 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|