C27H24ClNO7 — CID 4692182
dimethyl 2-[3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoylamino]benzene-1,4-dicarboxylate (PubChem CID 4692182) has the molecular formula C27H24ClNO7 and a molecular weight of 509.94 g/mol. Its IUPAC name is dimethyl 2-[3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoylamino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoylamino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 4692182 |
| Molecular Formula | C27H24ClNO7 |
| Molecular Weight | 509.94 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | dimethyl 2-[3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoylamino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C=Cc2ccc(OCc3ccc(Cl)cc3)c(OC)c2)c1 |
| InChI | InChI=1S/C27H24ClNO7/c1-33-24-14-17(6-12-23(24)36-16-18-4-9-20(28)10-5-18)7-13-25(30)29-22-15-19(26(31)34-2)8-11-21(22)27(32)35-3/h4-15H,16H2,1-3H3,(H,29,30) |
| InChIKey | CBBLXLJYBDLONY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|