C19H19F2NO5 — CID 6905479
1-[3-[[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxymethyl]-4-methoxyphenyl]ethanone (PubChem CID 6905479) has the molecular formula C19H19F2NO5 and a molecular weight of 379.36 g/mol. Its IUPAC name is 1-[3-[[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxymethyl]-4-methoxyphenyl]ethanone.
| Compound Name | 1-[3-[[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxymethyl]-4-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 6905479 |
| Molecular Formula | C19H19F2NO5 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[3-[[(E)-[4-(difluoromethoxy)-3-methoxyphenyl]methylideneamino]oxymethyl]-4-methoxyphenyl]ethanone |
| SMILES | COc1ccc(C(C)=O)cc1CO/N=C/c1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C19H19F2NO5/c1-12(23)14-5-7-16(24-2)15(9-14)11-26-22-10-13-4-6-17(27-19(20)21)18(8-13)25-3/h4-10,19H,11H2,1-3H3/b22-10+ |
| InChIKey | MTDSLIDLFZVXID-LSHDLFTRSA-N |
| XLogP | 4.06 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|