C17H22N4O6 — CID 7667489
(2Z)-N-(2-methoxy-4-nitrophenyl)-2-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethoxy]iminoacetamide (PubChem CID 7667489) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is (2Z)-N-(2-methoxy-4-nitrophenyl)-2-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethoxy]iminoacetamide.
| Compound Name | (2Z)-N-(2-methoxy-4-nitrophenyl)-2-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethoxy]iminoacetamide |
|---|---|
| PubChem CID | 7667489 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (2Z)-N-(2-methoxy-4-nitrophenyl)-2-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethoxy]iminoacetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)/C=N\OCC(=O)N1CCCC[C@H]1C |
| InChI | InChI=1S/C17H22N4O6/c1-12-5-3-4-8-20(12)17(23)11-27-18-10-16(22)19-14-7-6-13(21(24)25)9-15(14)26-2/h6-7,9-10,12H,3-5,8,11H2,1-2H3,(H,19,22)/b18-10-/t12-/m1/s1 |
| InChIKey | LWNCDGBZWFKFLA-HIPMGEKLSA-N |
| XLogP | 1.95 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|