C16H20N6O4S — CID 92678651
1-(2-methoxy-4-nitrophenyl)-3-[5-[(2R)-2-methylpiperidin-1-yl]-1,3,4-thiadiazol-2-yl]urea (PubChem CID 92678651) has the molecular formula C16H20N6O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 1-(2-methoxy-4-nitrophenyl)-3-[5-[(2R)-2-methylpiperidin-1-yl]-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(2-methoxy-4-nitrophenyl)-3-[5-[(2R)-2-methylpiperidin-1-yl]-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 92678651 |
| Molecular Formula | C16H20N6O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-(2-methoxy-4-nitrophenyl)-3-[5-[(2R)-2-methylpiperidin-1-yl]-1,3,4-thiadiazol-2-yl]urea |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)Nc1nnc(N2CCCC[C@H]2C)s1 |
| InChI | InChI=1S/C16H20N6O4S/c1-10-5-3-4-8-21(10)16-20-19-15(27-16)18-14(23)17-12-7-6-11(22(24)25)9-13(12)26-2/h6-7,9-10H,3-5,8H2,1-2H3,(H2,17,18,19,23)/t10-/m1/s1 |
| InChIKey | JRAAVSMDQWENJQ-SNVBAGLBSA-N |
| XLogP | 3.48 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|