C17H22N6O4S — CID 46271131
1-[5-[cyclohexyl(methyl)amino]-1,3,4-thiadiazol-2-yl]-3-(2-methoxy-5-nitrophenyl)urea (PubChem CID 46271131) has the molecular formula C17H22N6O4S and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-[5-[cyclohexyl(methyl)amino]-1,3,4-thiadiazol-2-yl]-3-(2-methoxy-5-nitrophenyl)urea.
| Compound Name | 1-[5-[cyclohexyl(methyl)amino]-1,3,4-thiadiazol-2-yl]-3-(2-methoxy-5-nitrophenyl)urea |
|---|---|
| PubChem CID | 46271131 |
| Molecular Formula | C17H22N6O4S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-[5-[cyclohexyl(methyl)amino]-1,3,4-thiadiazol-2-yl]-3-(2-methoxy-5-nitrophenyl)urea |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)Nc1nnc(N(C)C2CCCCC2)s1 |
| InChI | InChI=1S/C17H22N6O4S/c1-22(11-6-4-3-5-7-11)17-21-20-16(28-17)19-15(24)18-13-10-12(23(25)26)8-9-14(13)27-2/h8-11H,3-7H2,1-2H3,(H2,18,19,20,24) |
| InChIKey | HMPWDTOVEHPVAX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|