C20H27N3OS — CID 8656989
1-[(2R)-2-(diethylamino)-2-phenylethyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 8656989) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-[(2R)-2-(diethylamino)-2-phenylethyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(2R)-2-(diethylamino)-2-phenylethyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8656989 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-[(2R)-2-(diethylamino)-2-phenylethyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | CCN(CC)[C@@H](CNC(=S)Nc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H27N3OS/c1-4-23(5-2)19(16-9-7-6-8-10-16)15-21-20(25)22-17-11-13-18(24-3)14-12-17/h6-14,19H,4-5,15H2,1-3H3,(H2,21,22,25)/t19-/m0/s1 |
| InChIKey | JUVPDHCPEWPAPG-IBGZPJMESA-N |
| XLogP | 4.06 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|