C23H24N2OS — CID 7328313
1-[(1R)-1-(4-methoxyphenyl)-2-phenylethyl]-1-methyl-3-phenylthiourea (PubChem CID 7328313) has the molecular formula C23H24N2OS and a molecular weight of 376.53 g/mol. Its IUPAC name is 1-[(1R)-1-(4-methoxyphenyl)-2-phenylethyl]-1-methyl-3-phenylthiourea.
| Compound Name | 1-[(1R)-1-(4-methoxyphenyl)-2-phenylethyl]-1-methyl-3-phenylthiourea |
|---|---|
| PubChem CID | 7328313 |
| Molecular Formula | C23H24N2OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[(1R)-1-(4-methoxyphenyl)-2-phenylethyl]-1-methyl-3-phenylthiourea |
| SMILES | COc1ccc([C@@H](Cc2ccccc2)N(C)C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2OS/c1-25(23(27)24-20-11-7-4-8-12-20)22(17-18-9-5-3-6-10-18)19-13-15-21(26-2)16-14-19/h3-16,22H,17H2,1-2H3,(H,24,27)/t22-/m1/s1 |
| InChIKey | GNVVZWXZSMDMGA-JOCHJYFZSA-N |
| XLogP | 5.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|