C17H20N2O — CID 145175993
(3S)-2-N-(4-methoxyphenyl)-4-phenylbut-1-ene-2,3-diamine (PubChem CID 145175993) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (3S)-2-N-(4-methoxyphenyl)-4-phenylbut-1-ene-2,3-diamine.
| Compound Name | (3S)-2-N-(4-methoxyphenyl)-4-phenylbut-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 145175993 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (3S)-2-N-(4-methoxyphenyl)-4-phenylbut-1-ene-2,3-diamine |
| SMILES | C=C(Nc1ccc(OC)cc1)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C17H20N2O/c1-13(17(18)12-14-6-4-3-5-7-14)19-15-8-10-16(20-2)11-9-15/h3-11,17,19H,1,12,18H2,2H3/t17-/m0/s1 |
| InChIKey | IJMXZEWJBCODQW-KRWDZBQOSA-N |
| XLogP | 3.19 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |