C22H32N3OS+ — CID 8655016
[(1R)-2-[(2,6-diethylphenyl)carbamothioylamino]-1-(2-methoxyphenyl)ethyl]-dimethylazanium (PubChem CID 8655016) has the molecular formula C22H32N3OS+ and a molecular weight of 386.59 g/mol. Its IUPAC name is [(1R)-2-[(2,6-diethylphenyl)carbamothioylamino]-1-(2-methoxyphenyl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[(2,6-diethylphenyl)carbamothioylamino]-1-(2-methoxyphenyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8655016 |
| Molecular Formula | C22H32N3OS+ |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | [(1R)-2-[(2,6-diethylphenyl)carbamothioylamino]-1-(2-methoxyphenyl)ethyl]-dimethylazanium |
| SMILES | CCc1cccc(CC)c1NC(=S)NC[C@@H](c1ccccc1OC)[NH+](C)C |
| InChI | InChI=1S/C22H31N3OS/c1-6-16-11-10-12-17(7-2)21(16)24-22(27)23-15-19(25(3)4)18-13-8-9-14-20(18)26-5/h8-14,19H,6-7,15H2,1-5H3,(H2,23,24,27)/p+1/t19-/m0/s1 |
| InChIKey | OUKYLADVCVHOFW-IBGZPJMESA-O |
| XLogP | 2.99 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|