C18H20ClFN2OS — CID 4584883
1-(3-chloro-4-fluorophenyl)-3-[1-(2,6-dimethylphenoxy)propan-2-yl]thiourea (PubChem CID 4584883) has the molecular formula C18H20ClFN2OS and a molecular weight of 366.89 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[1-(2,6-dimethylphenoxy)propan-2-yl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[1-(2,6-dimethylphenoxy)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 4584883 |
| Molecular Formula | C18H20ClFN2OS |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[1-(2,6-dimethylphenoxy)propan-2-yl]thiourea |
| SMILES | Cc1cccc(C)c1OCC(C)NC(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H20ClFN2OS/c1-11-5-4-6-12(2)17(11)23-10-13(3)21-18(24)22-14-7-8-16(20)15(19)9-14/h4-9,13H,10H2,1-3H3,(H2,21,22,24) |
| InChIKey | LVQCAUUXEJGRFR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|