C20H26N2OS — CID 100746500
1-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]-3-(3-methoxyphenyl)thiourea (PubChem CID 100746500) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100746500 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[(1S)-1-(2,4-dimethylphenyl)-2-methylpropyl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N[C@H](c2ccc(C)cc2C)C(C)C)c1 |
| InChI | InChI=1S/C20H26N2OS/c1-13(2)19(18-10-9-14(3)11-15(18)4)22-20(24)21-16-7-6-8-17(12-16)23-5/h6-13,19H,1-5H3,(H2,21,22,24)/t19-/m0/s1 |
| InChIKey | RYQPBXWSKJBTRM-IBGZPJMESA-N |
| XLogP | 5.00 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|