C20H30N2O2 — CID 109149567
4-N-tert-butyl-1-N-(2,4-dimethylphenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109149567) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 4-N-tert-butyl-1-N-(2,4-dimethylphenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-tert-butyl-1-N-(2,4-dimethylphenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149567 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 4-N-tert-butyl-1-N-(2,4-dimethylphenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCC(C(=O)NC(C)(C)C)CC2)c(C)c1 |
| InChI | InChI=1S/C20H30N2O2/c1-13-6-11-17(14(2)12-13)21-18(23)15-7-9-16(10-8-15)19(24)22-20(3,4)5/h6,11-12,15-16H,7-10H2,1-5H3,(H,21,23)(H,22,24) |
| InChIKey | RKFZSXFWYAKMKM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |