C14H18INO — CID 90130717
(1R)-N-(2,4-dimethylphenyl)-3-iodocyclopentane-1-carboxamide (PubChem CID 90130717) has the molecular formula C14H18INO and a molecular weight of 343.21 g/mol. Its IUPAC name is (1R)-N-(2,4-dimethylphenyl)-3-iodocyclopentane-1-carboxamide.
| Compound Name | (1R)-N-(2,4-dimethylphenyl)-3-iodocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 90130717 |
| Molecular Formula | C14H18INO |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | (1R)-N-(2,4-dimethylphenyl)-3-iodocyclopentane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCC(I)C2)c(C)c1 |
| InChI | InChI=1S/C14H18INO/c1-9-3-6-13(10(2)7-9)16-14(17)11-4-5-12(15)8-11/h3,6-7,11-12H,4-5,8H2,1-2H3,(H,16,17)/t11-,12?/m1/s1 |
| InChIKey | UETPMGMTGCXTML-JHJMLUEUSA-N |
| XLogP | 3.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|