C17H16N4O4 — CID 108865659
ethyl [4-(1H-indazol-6-ylcarbamoylamino)phenyl] carbonate (PubChem CID 108865659) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is ethyl [4-(1H-indazol-6-ylcarbamoylamino)phenyl] carbonate.
| Compound Name | ethyl [4-(1H-indazol-6-ylcarbamoylamino)phenyl] carbonate |
|---|---|
| PubChem CID | 108865659 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | ethyl [4-(1H-indazol-6-ylcarbamoylamino)phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(NC(=O)Nc2ccc3cn[nH]c3c2)cc1 |
| InChI | InChI=1S/C17H16N4O4/c1-2-24-17(23)25-14-7-5-12(6-8-14)19-16(22)20-13-4-3-11-10-18-21-15(11)9-13/h3-10H,2H2,1H3,(H,18,21)(H2,19,20,22) |
| InChIKey | BXCZFULMPPBASZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|