C19H17Cl2N3O3 — CID 108873170
1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(2,3-dichlorophenyl)urea (PubChem CID 108873170) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 108873170 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(2,3-dichlorophenyl)urea |
| SMILES | CC(C)(C)N1C(=O)c2ccc(NC(=O)Nc3cccc(Cl)c3Cl)cc2C1=O |
| InChI | InChI=1S/C19H17Cl2N3O3/c1-19(2,3)24-16(25)11-8-7-10(9-12(11)17(24)26)22-18(27)23-14-6-4-5-13(20)15(14)21/h4-9H,1-3H3,(H2,22,23,27) |
| InChIKey | HQNLPVUWCBKCGP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|