C13H14N2O4 — CID 59622421
N-butyl-2-hydroxy-1,3-dioxoisoindole-5-carboxamide (PubChem CID 59622421) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is N-butyl-2-hydroxy-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-butyl-2-hydroxy-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 59622421 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-butyl-2-hydroxy-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)C(=O)N(O)C2=O |
| InChI | InChI=1S/C13H14N2O4/c1-2-3-6-14-11(16)8-4-5-9-10(7-8)13(18)15(19)12(9)17/h4-5,7,19H,2-3,6H2,1H3,(H,14,16) |
| InChIKey | PAEWZIYXKZAAAY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|