C12H14N2O7Si — CID 102214820
2-hydroxy-1,3-dioxo-N-(3-trihydroxysilylpropyl)isoindole-5-carboxamide (PubChem CID 102214820) has the molecular formula C12H14N2O7Si and a molecular weight of 326.34 g/mol. Its IUPAC name is 2-hydroxy-1,3-dioxo-N-(3-trihydroxysilylpropyl)isoindole-5-carboxamide.
| Compound Name | 2-hydroxy-1,3-dioxo-N-(3-trihydroxysilylpropyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 102214820 |
| Molecular Formula | C12H14N2O7Si |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-hydroxy-1,3-dioxo-N-(3-trihydroxysilylpropyl)isoindole-5-carboxamide |
| SMILES | O=C(NCCC[Si](O)(O)O)c1ccc2c(c1)C(=O)N(O)C2=O |
| InChI | InChI=1S/C12H14N2O7Si/c15-10(13-4-1-5-22(19,20)21)7-2-3-8-9(6-7)12(17)14(18)11(8)16/h2-3,6,18-21H,1,4-5H2,(H,13,15) |
| InChIKey | OIXDMYSBMBCJAG-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|