C26H33N5O7 — CID 176695825
tert-butyl (3S)-3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethylamino]-2-oxoethyl]pyrrolidine-1-carboxylate (PubChem CID 176695825) has the molecular formula C26H33N5O7 and a molecular weight of 527.58 g/mol. Its IUPAC name is tert-butyl (3S)-3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethylamino]-2-oxoethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethylamino]-2-oxoethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176695825 |
| Molecular Formula | C26H33N5O7 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | tert-butyl (3S)-3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]ethylamino]-2-oxoethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CC(=O)NCCNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C26H33N5O7/c1-26(2,3)38-25(37)30-11-8-15(14-30)12-21(33)28-10-9-27-16-4-5-17-18(13-16)24(36)31(23(17)35)19-6-7-20(32)29-22(19)34/h4-5,13,15,19,27H,6-12,14H2,1-3H3,(H,28,33)(H,29,32,34)/t15-,19?/m0/s1 |
| InChIKey | DJXDPPJIMBZTNS-FUKCDUGKSA-N |
| XLogP | 1.26 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|