C20H22N4O3S — CID 11338495
ethyl 3-[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]sulfanylanilino]-3-oxopropanoate (PubChem CID 11338495) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is ethyl 3-[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]sulfanylanilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]sulfanylanilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 11338495 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | ethyl 3-[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)phenyl]sulfanylanilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1ccc(Sc2ccc(NC3=NCCN3)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c1-2-27-19(26)13-18(25)23-14-3-7-16(8-4-14)28-17-9-5-15(6-10-17)24-20-21-11-12-22-20/h3-10H,2,11-13H2,1H3,(H,23,25)(H2,21,22,24) |
| InChIKey | CCTMMBMUJZLEFS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|