C16H19NO2 — CID 101044529
[(1E,3E,9E)-10-nitrodeca-1,3,9-trienyl]benzene (PubChem CID 101044529) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is [(1E,3E,9E)-10-nitrodeca-1,3,9-trienyl]benzene.
| Compound Name | [(1E,3E,9E)-10-nitrodeca-1,3,9-trienyl]benzene |
|---|---|
| PubChem CID | 101044529 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | [(1E,3E,9E)-10-nitrodeca-1,3,9-trienyl]benzene |
| SMILES | O=[N+]([O-])/C=C/CCCC/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H19NO2/c18-17(19)15-11-6-4-2-1-3-5-8-12-16-13-9-7-10-14-16/h3,5,7-15H,1-2,4,6H2/b5-3+,12-8+,15-11+ |
| InChIKey | SHANAUSRULCBCY-GUNMTSNISA-N |
| XLogP | 4.61 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|