C16H16N2O2 — CID 108903472
1-(4-hydroxyphenyl)-3-[(E)-2-(2-methylphenyl)ethenyl]urea (PubChem CID 108903472) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-[(E)-2-(2-methylphenyl)ethenyl]urea.
| Compound Name | 1-(4-hydroxyphenyl)-3-[(E)-2-(2-methylphenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108903472 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-[(E)-2-(2-methylphenyl)ethenyl]urea |
| SMILES | Cc1ccccc1/C=C/NC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-12-4-2-3-5-13(12)10-11-17-16(20)18-14-6-8-15(19)9-7-14/h2-11,19H,1H3,(H2,17,18,20)/b11-10+ |
| InChIKey | APDBJNVVXZVEKA-ZHACJKMWSA-N |
| XLogP | 3.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|