C16H15BrN2O2 — CID 108905003
1-[(E)-2-(2-bromophenyl)ethenyl]-3-(4-hydroxy-2-methylphenyl)urea (PubChem CID 108905003) has the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. Its IUPAC name is 1-[(E)-2-(2-bromophenyl)ethenyl]-3-(4-hydroxy-2-methylphenyl)urea.
| Compound Name | 1-[(E)-2-(2-bromophenyl)ethenyl]-3-(4-hydroxy-2-methylphenyl)urea |
|---|---|
| PubChem CID | 108905003 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1-[(E)-2-(2-bromophenyl)ethenyl]-3-(4-hydroxy-2-methylphenyl)urea |
| SMILES | Cc1cc(O)ccc1NC(=O)N/C=C/c1ccccc1Br |
| InChI | InChI=1S/C16H15BrN2O2/c1-11-10-13(20)6-7-15(11)19-16(21)18-9-8-12-4-2-3-5-14(12)17/h2-10,20H,1H3,(H2,18,19,21)/b9-8+ |
| InChIKey | QMKBHNNNZFOHKD-CMDGGOBGSA-N |
| XLogP | 4.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|