C16H15BrN2O — CID 108905000
1-benzyl-3-[(E)-2-(2-bromophenyl)ethenyl]urea (PubChem CID 108905000) has the molecular formula C16H15BrN2O and a molecular weight of 331.21 g/mol. Its IUPAC name is 1-benzyl-3-[(E)-2-(2-bromophenyl)ethenyl]urea.
| Compound Name | 1-benzyl-3-[(E)-2-(2-bromophenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108905000 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-benzyl-3-[(E)-2-(2-bromophenyl)ethenyl]urea |
| SMILES | O=C(N/C=C/c1ccccc1Br)NCc1ccccc1 |
| InChI | InChI=1S/C16H15BrN2O/c17-15-9-5-4-8-14(15)10-11-18-16(20)19-12-13-6-2-1-3-7-13/h1-11H,12H2,(H2,18,19,20)/b11-10+ |
| InChIKey | YKHNEYBZNQNCHL-ZHACJKMWSA-N |
| XLogP | 3.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |