C13H11BrN4O — CID 108905078
1-[(E)-2-(2-bromophenyl)ethenyl]-3-pyrimidin-2-ylurea (PubChem CID 108905078) has the molecular formula C13H11BrN4O and a molecular weight of 319.16 g/mol. Its IUPAC name is 1-[(E)-2-(2-bromophenyl)ethenyl]-3-pyrimidin-2-ylurea.
| Compound Name | 1-[(E)-2-(2-bromophenyl)ethenyl]-3-pyrimidin-2-ylurea |
|---|---|
| PubChem CID | 108905078 |
| Molecular Formula | C13H11BrN4O |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 1-[(E)-2-(2-bromophenyl)ethenyl]-3-pyrimidin-2-ylurea |
| SMILES | O=C(N/C=C/c1ccccc1Br)Nc1ncccn1 |
| InChI | InChI=1S/C13H11BrN4O/c14-11-5-2-1-4-10(11)6-9-17-13(19)18-12-15-7-3-8-16-12/h1-9H,(H2,15,16,17,18,19)/b9-6+ |
| InChIKey | CKCRBGJOFSCZDA-RMKNXTFCSA-N |
| XLogP | 3.03 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |