C28H24F3N3O2 — CID 11420463
(2E)-N-(1H-indol-5-yl)-2-[(4-propan-2-ylphenyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 11420463) has the molecular formula C28H24F3N3O2 and a molecular weight of 491.51 g/mol. Its IUPAC name is (2E)-N-(1H-indol-5-yl)-2-[(4-propan-2-ylphenyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | (2E)-N-(1H-indol-5-yl)-2-[(4-propan-2-ylphenyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 11420463 |
| Molecular Formula | C28H24F3N3O2 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | (2E)-N-(1H-indol-5-yl)-2-[(4-propan-2-ylphenyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CC(C)c1ccc(/C=C(/C(=O)Nc2cccc(C(F)(F)F)c2)C(=O)Nc2ccc3[nH]ccc3c2)cc1 |
| InChI | InChI=1S/C28H24F3N3O2/c1-17(2)19-8-6-18(7-9-19)14-24(26(35)33-22-5-3-4-21(16-22)28(29,30)31)27(36)34-23-10-11-25-20(15-23)12-13-32-25/h3-17,32H,1-2H3,(H,33,35)(H,34,36)/b24-14- |
| InChIKey | SDSQJUMPBBLJBH-OYKKKHCWSA-N |
| XLogP | 6.97 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|