C22H14Cl2F3N3O2 — CID 11317597
(2Z)-2-[(4-chlorophenyl)methylidene]-N-(2-chloro-4-pyridinyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 11317597) has the molecular formula C22H14Cl2F3N3O2 and a molecular weight of 480.27 g/mol. Its IUPAC name is (2Z)-2-[(4-chlorophenyl)methylidene]-N-(2-chloro-4-pyridinyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | (2Z)-2-[(4-chlorophenyl)methylidene]-N-(2-chloro-4-pyridinyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 11317597 |
| Molecular Formula | C22H14Cl2F3N3O2 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | (2Z)-2-[(4-chlorophenyl)methylidene]-N-(2-chloro-4-pyridinyl)-N'-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)/C(=C/c1ccc(Cl)cc1)C(=O)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C22H14Cl2F3N3O2/c23-15-6-4-13(5-7-15)10-18(21(32)30-17-8-9-28-19(24)12-17)20(31)29-16-3-1-2-14(11-16)22(25,26)27/h1-12H,(H,29,31)(H,28,30,32)/b18-10- |
| InChIKey | HFWKVHDZJYXPLX-ZDLGFXPLSA-N |
| XLogP | 6.07 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|