C26H18F6N2O5 — CID 11341868
2-[(7-methoxy-1,3-benzodioxol-5-yl)methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 11341868) has the molecular formula C26H18F6N2O5 and a molecular weight of 552.43 g/mol. Its IUPAC name is 2-[(7-methoxy-1,3-benzodioxol-5-yl)methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | 2-[(7-methoxy-1,3-benzodioxol-5-yl)methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 11341868 |
| Molecular Formula | C26H18F6N2O5 |
| Molecular Weight | 552.43 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 2-[(7-methoxy-1,3-benzodioxol-5-yl)methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | COc1cc(C=C(C(=O)Nc2cccc(C(F)(F)F)c2)C(=O)Nc2cccc(C(F)(F)F)c2)cc2c1OCO2 |
| InChI | InChI=1S/C26H18F6N2O5/c1-37-20-9-14(10-21-22(20)39-13-38-21)8-19(23(35)33-17-6-2-4-15(11-17)25(27,28)29)24(36)34-18-7-3-5-16(12-18)26(30,31)32/h2-12H,13H2,1H3,(H,33,35)(H,34,36) |
| InChIKey | AHAHRHRYAGBLOB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.43 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|