C21H13Cl2F3N4O2 — CID 91543878
N-(2-chloro-4-pyridinyl)-2-[(6-chloro-3-pyridinyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 91543878) has the molecular formula C21H13Cl2F3N4O2 and a molecular weight of 481.26 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-2-[(6-chloro-3-pyridinyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-2-[(6-chloro-3-pyridinyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 91543878 |
| Molecular Formula | C21H13Cl2F3N4O2 |
| Molecular Weight | 481.26 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-2-[(6-chloro-3-pyridinyl)methylidene]-N'-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C(=Cc1ccc(Cl)nc1)C(=O)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C21H13Cl2F3N4O2/c22-17-5-4-12(11-28-17)8-16(20(32)30-15-6-7-27-18(23)10-15)19(31)29-14-3-1-2-13(9-14)21(24,25)26/h1-11H,(H,29,31)(H,27,30,32) |
| InChIKey | OKSWJAXXFXTYOM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.26 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|