C30H25Cl2F6N3O4 — CID 11308415
2-[[3,5-dichloro-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 11308415) has the molecular formula C30H25Cl2F6N3O4 and a molecular weight of 676.44 g/mol. Its IUPAC name is 2-[[3,5-dichloro-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | 2-[[3,5-dichloro-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 11308415 |
| Molecular Formula | C30H25Cl2F6N3O4 |
| Molecular Weight | 676.44 g/mol |
| Exact Mass | 675.11 |
| IUPAC Name | 2-[[3,5-dichloro-2-(2-morpholin-4-ylethoxy)phenyl]methylidene]-N,N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C(=Cc1cc(Cl)cc(Cl)c1OCCN1CCOCC1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H25Cl2F6N3O4/c31-21-13-18(26(25(32)17-21)45-12-9-41-7-10-44-11-8-41)14-24(27(42)39-22-5-1-3-19(15-22)29(33,34)35)28(43)40-23-6-2-4-20(16-23)30(36,37)38/h1-6,13-17H,7-12H2,(H,39,42)(H,40,43) |
| InChIKey | JHBPNHAZRNTYGQ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.44 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|