C20H14F3N3O3 — CID 2941949
N-[3-oxo-1-pyridin-3-yl-3-[3-(trifluoromethyl)anilino]prop-1-en-2-yl]furan-2-carboxamide (PubChem CID 2941949) has the molecular formula C20H14F3N3O3 and a molecular weight of 401.34 g/mol. Its IUPAC name is N-[3-oxo-1-pyridin-3-yl-3-[3-(trifluoromethyl)anilino]prop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-oxo-1-pyridin-3-yl-3-[3-(trifluoromethyl)anilino]prop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2941949 |
| Molecular Formula | C20H14F3N3O3 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[3-oxo-1-pyridin-3-yl-3-[3-(trifluoromethyl)anilino]prop-1-en-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C(=Cc1cccnc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H14F3N3O3/c21-20(22,23)14-5-1-6-15(11-14)25-18(27)16(10-13-4-2-8-24-12-13)26-19(28)17-7-3-9-29-17/h1-12H,(H,25,27)(H,26,28) |
| InChIKey | AXRCQVOEAOWZPI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|