C19H13F3N2O3S — CID 1320934
N-[3-oxo-1-thiophen-2-yl-3-[3-(trifluoromethyl)anilino]prop-1-en-2-yl]furan-2-carboxamide (PubChem CID 1320934) has the molecular formula C19H13F3N2O3S and a molecular weight of 406.39 g/mol. Its IUPAC name is N-[3-oxo-1-thiophen-2-yl-3-[3-(trifluoromethyl)anilino]prop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-oxo-1-thiophen-2-yl-3-[3-(trifluoromethyl)anilino]prop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1320934 |
| Molecular Formula | C19H13F3N2O3S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | N-[3-oxo-1-thiophen-2-yl-3-[3-(trifluoromethyl)anilino]prop-1-en-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C(=Cc1cccs1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C19H13F3N2O3S/c20-19(21,22)12-4-1-5-13(10-12)23-17(25)15(11-14-6-3-9-28-14)24-18(26)16-7-2-8-27-16/h1-11H,(H,23,25)(H,24,26) |
| InChIKey | LIVUSSDQYZTMTE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|