C27H20N2O4S — CID 22787878
N-[(Z)-3-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide (PubChem CID 22787878) has the molecular formula C27H20N2O4S and a molecular weight of 468.53 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22787878 |
| Molecular Formula | C27H20N2O4S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-[(Z)-3-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)/C=C/c2ccco2)cc1)/C(=C/c1cccs1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H20N2O4S/c30-25(15-14-22-8-4-16-33-22)19-10-12-21(13-11-19)28-27(32)24(18-23-9-5-17-34-23)29-26(31)20-6-2-1-3-7-20/h1-18H,(H,28,32)(H,29,31)/b15-14+,24-18- |
| InChIKey | VBONKBILGWNERA-JUXXPISJSA-N |
| XLogP | 5.65 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|