C30H24N2O4 — CID 23094522
N-[(Z)-3-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-1-(2-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 23094522) has the molecular formula C30H24N2O4 and a molecular weight of 476.53 g/mol. Its IUPAC name is N-[(Z)-3-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-1-(2-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-1-(2-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 23094522 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-[(Z)-3-[4-[(E)-3-(furan-2-yl)prop-2-enoyl]anilino]-1-(2-methylphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccccc1/C=C(\NC(=O)c1ccccc1)C(=O)Nc1ccc(C(=O)/C=C/c2ccco2)cc1 |
| InChI | InChI=1S/C30H24N2O4/c1-21-8-5-6-11-24(21)20-27(32-29(34)23-9-3-2-4-10-23)30(35)31-25-15-13-22(14-16-25)28(33)18-17-26-12-7-19-36-26/h2-20H,1H3,(H,31,35)(H,32,34)/b18-17+,27-20- |
| InChIKey | LWJOFVYXUIABKF-RSXYPYOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|