C27H22F6N2O2 — CID 87963915
2-[(4-propan-2-ylphenyl)methylidene]-N',N'-bis[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 87963915) has the molecular formula C27H22F6N2O2 and a molecular weight of 520.47 g/mol. Its IUPAC name is 2-[(4-propan-2-ylphenyl)methylidene]-N',N'-bis[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | 2-[(4-propan-2-ylphenyl)methylidene]-N',N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 87963915 |
| Molecular Formula | C27H22F6N2O2 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-[(4-propan-2-ylphenyl)methylidene]-N',N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CC(C)c1ccc(C=C(C(N)=O)C(=O)N(c2cccc(C(F)(F)F)c2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H22F6N2O2/c1-16(2)18-11-9-17(10-12-18)13-23(24(34)36)25(37)35(21-7-3-5-19(14-21)26(28,29)30)22-8-4-6-20(15-22)27(31,32)33/h3-16H,1-2H3,(H2,34,36) |
| InChIKey | GOSVFLASEYRJKG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|