C30H22F6N4O3 — CID 87767037
2-[4-[(2-aminophenyl)carbamoyl]phenyl]-N',N'-bis[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 87767037) has the molecular formula C30H22F6N4O3 and a molecular weight of 600.52 g/mol. Its IUPAC name is 2-[4-[(2-aminophenyl)carbamoyl]phenyl]-N',N'-bis[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | 2-[4-[(2-aminophenyl)carbamoyl]phenyl]-N',N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 87767037 |
| Molecular Formula | C30H22F6N4O3 |
| Molecular Weight | 600.52 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | 2-[4-[(2-aminophenyl)carbamoyl]phenyl]-N',N'-bis[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | NC(=O)C(C(=O)N(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1)c1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C30H22F6N4O3/c31-29(32,33)19-5-3-7-21(15-19)40(22-8-4-6-20(16-22)30(34,35)36)28(43)25(26(38)41)17-11-13-18(14-12-17)27(42)39-24-10-2-1-9-23(24)37/h1-16,25H,37H2,(H2,38,41)(H,39,42) |
| InChIKey | VDTJJSJDKXZUSF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|