C30H30N6O3 — CID 69287198
2-[4-[(2-aminophenyl)carbamoyl]phenyl]-N',N'-bis(2-pyridin-4-ylethyl)propanediamide (PubChem CID 69287198) has the molecular formula C30H30N6O3 and a molecular weight of 522.61 g/mol. Its IUPAC name is 2-[4-[(2-aminophenyl)carbamoyl]phenyl]-N',N'-bis(2-pyridin-4-ylethyl)propanediamide.
| Compound Name | 2-[4-[(2-aminophenyl)carbamoyl]phenyl]-N',N'-bis(2-pyridin-4-ylethyl)propanediamide |
|---|---|
| PubChem CID | 69287198 |
| Molecular Formula | C30H30N6O3 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 2-[4-[(2-aminophenyl)carbamoyl]phenyl]-N',N'-bis(2-pyridin-4-ylethyl)propanediamide |
| SMILES | NC(=O)C(C(=O)N(CCc1ccncc1)CCc1ccncc1)c1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C30H30N6O3/c31-25-3-1-2-4-26(25)35-29(38)24-7-5-23(6-8-24)27(28(32)37)30(39)36(19-13-21-9-15-33-16-10-21)20-14-22-11-17-34-18-12-22/h1-12,15-18,27H,13-14,19-20,31H2,(H2,32,37)(H,35,38) |
| InChIKey | ZCUHBYBDRXIQIY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|