C24H22N6OS — CID 164615117
N-(2-aminophenyl)-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide (PubChem CID 164615117) has the molecular formula C24H22N6OS and a molecular weight of 442.55 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 164615117 |
| Molecular Formula | C24H22N6OS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-(2-aminophenyl)-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanylmethyl]benzamide |
| SMILES | C=CCn1c(SCc2ccc(C(=O)Nc3ccccc3N)cc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C24H22N6OS/c1-2-15-30-22(18-11-13-26-14-12-18)28-29-24(30)32-16-17-7-9-19(10-8-17)23(31)27-21-6-4-3-5-20(21)25/h2-14H,1,15-16,25H2,(H,27,31) |
| InChIKey | FJGMSTGHAUPHKC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|