C24H28N4OS — CID 42810659
N-butan-2-yl-4-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide (PubChem CID 42810659) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is N-butan-2-yl-4-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide.
| Compound Name | N-butan-2-yl-4-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 42810659 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-butan-2-yl-4-[[5-(4-methylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzamide |
| SMILES | C=CCn1c(SCc2ccc(C(=O)NC(C)CC)cc2)nnc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C24H28N4OS/c1-5-15-28-22(20-11-7-17(3)8-12-20)26-27-24(28)30-16-19-9-13-21(14-10-19)23(29)25-18(4)6-2/h5,7-14,18H,1,6,15-16H2,2-4H3,(H,25,29) |
| InChIKey | YAIKVRMOFRIEGO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|