C29H32N2O2 — CID 3331137
N,N'-bis(3,4-dimethylphenyl)-2-[(4-propan-2-ylphenyl)methylidene]propanediamide (PubChem CID 3331137) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N,N'-bis(3,4-dimethylphenyl)-2-[(4-propan-2-ylphenyl)methylidene]propanediamide.
| Compound Name | N,N'-bis(3,4-dimethylphenyl)-2-[(4-propan-2-ylphenyl)methylidene]propanediamide |
|---|---|
| PubChem CID | 3331137 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N,N'-bis(3,4-dimethylphenyl)-2-[(4-propan-2-ylphenyl)methylidene]propanediamide |
| SMILES | Cc1ccc(NC(=O)C(=Cc2ccc(C(C)C)cc2)C(=O)Nc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C29H32N2O2/c1-18(2)24-11-9-23(10-12-24)17-27(28(32)30-25-13-7-19(3)21(5)15-25)29(33)31-26-14-8-20(4)22(6)16-26/h7-18H,1-6H3,(H,30,32)(H,31,33) |
| InChIKey | DMNLTCSAELAUQU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|