C16H16N4O — CID 155412355
1-(4,6-dimethyl-2-pyridinyl)-3-(1H-indol-5-yl)urea (PubChem CID 155412355) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-pyridinyl)-3-(1H-indol-5-yl)urea.
| Compound Name | 1-(4,6-dimethyl-2-pyridinyl)-3-(1H-indol-5-yl)urea |
|---|---|
| PubChem CID | 155412355 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(4,6-dimethyl-2-pyridinyl)-3-(1H-indol-5-yl)urea |
| SMILES | Cc1cc(C)nc(NC(=O)Nc2ccc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C16H16N4O/c1-10-7-11(2)18-15(8-10)20-16(21)19-13-3-4-14-12(9-13)5-6-17-14/h3-9,17H,1-2H3,(H2,18,19,20,21) |
| InChIKey | BMURWLZNQFJJAX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |