C16H16N4O2 — CID 75523388
1-(4,6-dimethyl-2-pyridinyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea (PubChem CID 75523388) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-pyridinyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea.
| Compound Name | 1-(4,6-dimethyl-2-pyridinyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
|---|---|
| PubChem CID | 75523388 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(4,6-dimethyl-2-pyridinyl)-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
| SMILES | Cc1cc(C)nc(NC(=O)Nc2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C16H16N4O2/c1-9-5-10(2)17-14(6-9)20-16(22)18-12-3-4-13-11(7-12)8-15(21)19-13/h3-7H,8H2,1-2H3,(H,19,21)(H2,17,18,20,22) |
| InChIKey | LKKACYROLCOUJT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |