C13H9ClF10N2O — CID 4613266
6-chloro-N-(4,6-dimethyl-2-pyridinyl)-2,2,3,3,4,4,5,5,6,6-decafluorohexanamide (PubChem CID 4613266) has the molecular formula C13H9ClF10N2O and a molecular weight of 434.66 g/mol. Its IUPAC name is 6-chloro-N-(4,6-dimethyl-2-pyridinyl)-2,2,3,3,4,4,5,5,6,6-decafluorohexanamide.
| Compound Name | 6-chloro-N-(4,6-dimethyl-2-pyridinyl)-2,2,3,3,4,4,5,5,6,6-decafluorohexanamide |
|---|---|
| PubChem CID | 4613266 |
| Molecular Formula | C13H9ClF10N2O |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 6-chloro-N-(4,6-dimethyl-2-pyridinyl)-2,2,3,3,4,4,5,5,6,6-decafluorohexanamide |
| SMILES | Cc1cc(C)nc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)c1 |
| InChI | InChI=1S/C13H9ClF10N2O/c1-5-3-6(2)25-7(4-5)26-8(27)9(15,16)10(17,18)11(19,20)12(21,22)13(14,23)24/h3-4H,1-2H3,(H,25,26,27) |
| InChIKey | CETODVJASBZMHF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|