C11H9F4NO3 — CID 112743060
ethyl 3-(3,5-difluoroanilino)-2,2-difluoro-3-oxopropanoate (PubChem CID 112743060) has the molecular formula C11H9F4NO3 and a molecular weight of 279.19 g/mol. Its IUPAC name is ethyl 3-(3,5-difluoroanilino)-2,2-difluoro-3-oxopropanoate.
| Compound Name | ethyl 3-(3,5-difluoroanilino)-2,2-difluoro-3-oxopropanoate |
|---|---|
| PubChem CID | 112743060 |
| Molecular Formula | C11H9F4NO3 |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | ethyl 3-(3,5-difluoroanilino)-2,2-difluoro-3-oxopropanoate |
| SMILES | CCOC(=O)C(F)(F)C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H9F4NO3/c1-2-19-10(18)11(14,15)9(17)16-8-4-6(12)3-7(13)5-8/h3-5H,2H2,1H3,(H,16,17) |
| InChIKey | JPYBAIPGOKDQLO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|